Aspartamo

Wikipedia, Entziklopedia askea
Aspartamo
Aspartame.svg
Formula kimikoaC14H18N2O5
SMILES kanonikoa2D eredua
SMILES isomerikoa
COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N
InChl3D eredua
Osatutaoxigeno eta karbono
Masa molekularra294,122 Da
Erabilera
RolaEdulkoratzaile
Arriskuak
NFPA 704
NFPA 704.svg
1
1
0
Identifikatzaileak
InChlKeyIAOZJIPTCAWIRG-QWRGUYRKSA-N
CAS zenbakia22839-47-0
ChemSpider118630
PubChem134601
Reaxys2223850
Gmelin2877
ChEMBLCHEMBL171679
EC zenbakia245-261-3
ECHA100.041.132
CosIng32015
MeSHD001218
RxNorm1311524
Human Metabolome DatabaseHMDB0001894
UNIIZ0H242BBR1
NDF-RTN0000022565
KEGGD02381 eta C11045
PDB LigandPME

Aspartamoa fenilalanina eta azido aspartikoz osatutako substantzia da, azukrearen ordezko edulkoratzaile gisa erabilia.[1] 1965ean G. D. Searle and Companyk aurkitua, Europan E-951 kodea du.

Aspartamoa azukrea baino 150 eta 200 aldiz gozoagoa da. Edulkoratzaile guztiak sakarosa edo azukre arruntarekin alderatuak sailkatzen dituzte, eta, beraz, 200 aldiz balio hori laborategian egindako %15ean diluzioekin (gozotasun erlatiboa = 100) alderatzean lortzen dute.[2]

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Euskalterm: [Hiztegi Terminologikoa] [2009]
  2. (Ingelesez) DuBois, Grant E.. (1991-12-31). Concentration—Response Relationships of Sweeteners A Systematic Study. 450 doi:10.1021/bk-1991-0450.ch020..

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.