Aspartamo

Wikipedia, Entziklopedia askea
Aspartamo
Aspartame.svg
Formula kimikoa C₁₄H₁₈N₂O₅
SMILES kanonikoa 2D eredua
SMILES isomerikoa
COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N
InChl 3D eredua
Osatuta oxigeno eta karbono
Masa molekularra 294,122 u
Erabilera
Rola sugar substitute (en) Itzuli
Arriskuak
NFPA 704
NFPA 704.svg
1
1
0
Identifikatzaileak
InChlKey IAOZJIPTCAWIRG-QWRGUYRKSA-N
CAS zenbakia 22839-47-0
ChemSpider 118630
PubChem 134601
Reaxys 2223850
Gmelin 2877
ChEMBL CHEMBL171679
EC zenbakia 245-261-3
ECHA 100.041.132
CosIng 32015
MeSH D001218
RxNorm 1311524
Human Metabolome Database HMDB0001894
UNII Z0H242BBR1
NDF-RT N0000022565
KEGG D02381 eta C11045
PDB Ligand PME

Aspartamoa fenilalanina eta azido aspartikoz osatutako substantzia da, azukrearen ordezko edulkoratzaile gisa erabilia.[1] 1965ean G. D. Searle and Companyk aurkitua, Europan E-951 kodea du.

Aspartamoa azukrea baino 150 eta 200 aldiz gozoagoa da. Edulkoratzaile guztiak sakarosa edo azukre arruntarekin alderatuak sailkatzen dituzte, eta, beraz, 200 aldiz balio hori laborategian egindako %15ean diluzioekin (gozotasun erlatiboa = 100) alderatzean lortzen dute.[2]

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Euskalterm: [Hiztegi Terminologikoa] [2009]
  2. (Ingelesez) DuBois, Grant E.. (1991-12-31). Concentration—Response Relationships of Sweeteners A Systematic Study. 450 doi:10.1021/bk-1991-0450.ch020.

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.