Azido abietiko

Wikipedia, Entziklopedia askea
Azido abietiko
Abietinsäure.svg
Formula kimikoaC20H30O2
SMILES kanonikoa2D eredua
SMILES isomerikoa
CC(C)C1=CC2=CC[C@@H]3[C@@]([C@H]2CC1)(CCC[C@@]3(C)C(=O)O)C
InChl3D eredua
Osatutaoxigeno eta karbono
EponimoaIzei
Ezaugarriak
Fusio-puntua174 °C
161 °C
Masa molekularra302,225 Da
Erabilera
Rolafibrinolytic agents (en) Itzuli eta free radical scavengers (en) Itzuli
Identifikatzaileak
InChlKeyRSWGJHLUYNHPMX-ONCXSQPRSA-N
CAS zenbakia514-10-3
ChemSpider10127
PubChem10569
Reaxys2221451
Gmelin28987
ChEBI114879
ChEMBLCHEMBL71893
RTECS zenbakiaTP8580000
ZVG20590
DSSTox zenbakiaTP8580000
EC zenbakia208-178-3
ECHA100.007.436
CosIng74137
MeSHC023710
KNApSAcKC00000871
UNIIV3DHX33184
KEGGC06087
PDB LigandA9H

Azido abietikoa C30H29-CO2 formula duen molekula organiko bat da, egitura aldetik diterpenoa. Molekula anfipatikoa da.

Jatorria[aldatu | aldatu iturburu kodea]

Koniferoetako erretxina den kolofoniatik ateratzen da, bai eta trementinatik ere[1]. Abietanoaren taldekoa da.

Erabilerak[aldatu | aldatu iturburu kodea]

Mendeetan zehar untziak bikeztatzeko erabili izan da[2]. Gaur egun erretxina goma bihurtzen da eta lakak, bernizak eta xaboiak egiteko erabiltzen da[2].

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. (Ingelesez) «http://www.orgsyn.org/demo.aspx?prep=CV4P0001» www.orgsyn.org (Noiz kontsultatua: 2018-12-29).
  2. a b Hoiberg, Dale H.. (2010). "abietic acid". Encyclopædia Britannica. I: A-ak Bayes. Encyclopædia Britannica Inc, 32 or. ISBN 978-1-59339-837-8..
Kolofonia, koniferoen erretxina.

Kanpo estekak[aldatu | aldatu iturburu kodea]