Azido karminiko

Wikipedia, Entziklopedia askea
Azido karminiko
Carminic acid structure.svg
Formula kimikoaC22H20O13
SMILES kanonikoa2D eredua
SMILES isomerikoa
CC1=C2C(=CC(=C1C(=O)O)O)C(=O)C3=C(C2=O)C(=C(C(=C3O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O
InChl3D eredua
Osatutaoxigeno eta karbono
Masa molekularra492,09 Da
Identifikatzaileak
InChlKeyDGQLVPJVXFOQEV-JNVSTXMASA-N
CAS zenbakia1260-17-9
ChemSpider8430568
PubChem10255083
Gmelin78310
ChEMBLCHEMBL263094
EC zenbakia215-023-3
ECHA100.013.658
RxNorm1368643
Human Metabolome DatabaseHMDB0030658
UNIICID8Z8N95N
KEGGC11254

Azido karminikoa edo kukurutx-karmina[1] (C22H20O13) elikagai koloragarri gorria da, elikagaien industrian (non E-120 kodea duen) gehigarri bezala erabiltzen dutena. Kukurutxetatik aterata, normalean Ponceau 4Rk ordezkatzen du.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Euskalterm: [Hiztegi Terminologikoa] [2005]

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.