«Trinitrotolueno»: berrikuspenen arteko aldeak

Jump to navigation Jump to search
ez dago edizio laburpenik
{| align="right" width="1"
| Verifiedfields = changed
| verifiedrevid = 458775807
| align="center" | [[Fitxategi:TNT-3D-balls.png|180 px]][[Fitxategi:Trinitrotoluene.svg|150px]]<br />2,4,6-Trinitrotoluenoa
| ImageFileL1 = Trinitrotoluene.svg
| ImageSizeL1 = 120px
| ImageFileR1 = TNT-from-xtal-1982-3D-balls.png
| ImageSizeR1 = 120px
| ImageFile2 = TNT flakes.jpg
| ImageSize2 =
| ImageAlt2 =
| IUPACName = 2-metil-1,3,5-trinitrobentzeno
| OtherNames = 2,4,6-Trinitrotolueno,<br>TNT, Trilita, Tolita, Trinol, Trotil, Tritolo, Tritolol, Triton, Tritona, Trotol, Trinitrotoluol,<br>2,4,6-Trinitromethylbentzeno
| Section1 = {{Chembox Identifiers
| Abbreviations = TNT
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8073
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1236345
| UNII_Ref = {{fdacite|correct|FDA}}
| InChI1 = 1/C7H5N3O6/c1-4-2-3-5(8(11)12)7(10(15)16)6(4)9(13)14/h2-3H,1H3
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 118-96-7
| UNNumber = 0209 – ''Lehorra edo < %30 uran''<br/>0388, 0389 – ''trinitrobentzeno edo hexanitrostilbenorekin''
| EINECS = 204-289-6
| PubChem = 11763
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01676
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C7H5N3O6/c1-4-2-3-5(8(11)12)7(10(15)16)6(4)9(13)14/h2-3H,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| SMILES = O=[N+]([O-])c1c(c(ccc1C)[N+]([O-])=O)[N+]([O-])=O
| InChI = 1/C7H5N3O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3
| RTECS = XU0175000
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C16391
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = C<sub>7</sub>H<sub>5</sub>N<sub>3</sub>O<sub>6</sub>
| MolarMass = 227.13 g/mol
| Appearance = Hori argia
| Density = 1.654 g/cm<sup>3</sup>
| MeltingPt = 80.35 °C
| Melting_notes =
| BoilingPt = 240 °C
| Boiling_notes = Zatitzen da<ref>http://www.inchem.org/documents/icsc/icsc/eics0967.htm</ref>
| Solubility = 0.13 g/L (20 °C)
| SolubleOther = disolbagarri
| Solvent = [[eter]], [[azetona]], [[bentzeno]], [[piridina]]
| pKa =
| pKb = }}
| Section6 = {{Chembox Explosive
| ShockSens = Gogor
| FrictionSens = Gogor 353 N-ra arte
| ExplosiveV = 6900 m/s
| REFactor = 1.00
| Section7 = {{Chembox Hazards
| ExternalMSDS = [http://www.inchem.org/documents/icsc/icsc/eics0967.htm ICSC 0967]
| EUClass = Lehergarri ('''E''')<br/>Toxiko ('''T''')<br/>Ingurumenerako arriskutsu ('''N''')
| EUIndex = 609-008-00-4
| NFPA-H = 2
| NFPA-F = 4
| NFPA-R = 4
| NFPA-O =
| RPhrases = {{R2}}, {{R23/24/25}}, {{R33}}, {{R51/53}}
| SPhrases = {{S1/2}}, {{S35}}, {{S45}}, {{S61}}
| FlashPt = 167°C
| Autoignition =
| ExploLimits =
| PEL = }}
| Section8 = {{Chembox Related
| OtherCpds = [[Azido pikriko]]<br>[[hexanitrobentzeno]]<br>[[2,4-Dinitrotolueno]]}}
'''Trinitrotoluenoa''' ('''TNT''') edo '''2,4,6-trinitro-1-metilbenzenoa''' ([[IUPAC]] notazioa) kolore hori argiko [[kristal]]ezko [[hidrokarburo|hidrokarburo aromatikoa]] da, 81 [[gradu zentigrado|ºC]]-tan urtzen dena. [[Lehergailu]]ak egiteko [[konposatu kimiko]]a da eta hainbat nahasketa-leherkorretatik sortzen da, adibidez [[amatol]]a, TNT [[amonio nitrato]]arekin nahastuz sortzen dena. [[Tolueno]]aren [[nitratazio]]tik sortzen da ([[Karbono|C]]<sub>6</sub>[[Hidrogeno|H]]<sub>5</sub>[[Karbono|C]][[Hidrogeno|H]]<sub>3</sub>); zeinen formula kimikoa
Ez du [[metal]]ekin erreakzionatzen, ezta ura xurgatzen ere. Horregatik, oso egonkorra da denbora-tarte luzeetan almazenatuabiltegiratua izateko, [[dinamita]] ez bezala.
== Erreferentziak ==


Nabigazio menua