Guanosina difosfato

Wikipedia, Entziklopedia askea
Guanosina difosfato
Guanosindiphosphat protoniert.svg
Formula kimikoaC10H15N5O11P2
SMILES kanonikoa2D eredua
SMILES isomerikoa
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N
InChl3D eredua
Osatutanitrogeno, oxigeno eta karbono
Masa molekularra443,024 Da
Identifikatzaileak
InChlKeyQGWNDRXFNXRZMB-UUOKFMHZSA-N
CAS zenbakia146-91-8
ChemSpider8630
PubChem8977
Gmelin17552
ChEMBLCHEMBL384759
MeSHD006153
Human Metabolome DatabaseHMDB0001201
KEGGC00035
PDB LigandGDP

Guanosina difosfatoa edo GDP nukleotido bat da, guanosinaz, erribosaz eta bi fosfato taldez osatua. Nukleotido difosfatoa da, beraz.

GDPa GTPa edo guanosina trifosfatoa defosforilatzen denean agertzen da. Askatutako fosfato taldea proteina bati transferitu ahal izaten zaio.

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.