Indigo-karmin

Wikipedia, Entziklopedia askea
Indigo-karmin
Indigo carmine.svg
Formula kimikoaC16H8N2Na2O8S2
SMILES kanonikoa[O-)C(=O)C(=C3C(=O)C4=C(N3)C=CC(=C4)S(=O)(=O)[O-])N2.[Na+].[Na+]&zoom=2.0&annotate=none 2D eredua]
SMILES isomerikoa
C1=CC2=C(C=C1S(=O)(=O)[O-])C(=O)/C(=C\3/C(=O)C4=C(N3)C=CC(=C4)S(=O)(=O)[O-])/N2.[Na+].[Na+]
InChl3D eredua
Osatutakarbono
Masa molekularra465,951746 Da
Erabilera
RolaTindu
Arriskuak
NFPA 704
NFPA 704.svg
0
1
0
GHS arriskuawarning (en) Itzuli
GHS-pictogram-exclam.svg
Arrisku motakH302 (en) Itzuli
Prekauzio motakbaliorik ez
Identifikatzaileak
InChlKeyKHLVKKOJDHCJMG-QDBORUFSSA-L
CAS zenbakia860-22-0
ChemSpider4447431
PubChem5284351
Reaxys905434
Gmelin31695
ChEMBLCHEMBL2105023
ZVG107539
EC zenbakia212-728-8
ECHA100.011.572
CosIng31612
MeSHD007203
RxNorm227312
Human Metabolome DatabaseHMDB0059912
UNIID3741U8K7L
NDF-RTN0000148133 eta N0000146442
KEGGD01563

Indigo-karmina[1] edo indigotina[2] elikagai koloragarri sintetiko urdina da, elikagaien industrian (non E-132 kodea duen) gehigarri bezala erabiltzen dutena . Anil zuhaixkatik aterata, pH-adierazle moduan ere erabiltzen dute.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Euskalterm: [Kontsulta-fitxak] [2002]
  2. Euskalterm: [Hiztegi Terminologikoa] [2005]

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.