Metamizol

Wikipedia, Entziklopedia askea
Ohar medikoa
Oharra: Wikipediak ez du mediku aholkurik ematen. Tratamendua behar duzula uste baduzu, jo ezazu sendagilearengana.
Metamizol
Metamizol.svg
Formula kimikoaC13H16N3NaO4S
SMILES kanonikoa[O-.[Na+]&zoom=2.0&annotate=none 2D eredua]
SMILES isomerikoa
[Na+].CN(CS([O-])(=O)=O)C1=C(C)N(C)N(C1=O)C2=CC=CC=C2
InChl3D eredua
Osatutasufre eta karbono
Masa molekularra333,075921 Da
Identifikatzaileak
InChlKeyDJGAAPFSPWAYTJ-UHFFFAOYSA-M
CAS zenbakia68-89-3
ChemSpider6000
PubChem522325
Reaxys3643594
Gmelin59033
ChEMBLCHEMBL487894
EC zenbakia200-694-7
ECHA100.000.631
RxNorm1537943
UNIIVSU62Z74ON
KEGGD08190

Metamizol analgesiko eta antipiretiko oso zabaldua da, 1920an lehen aldiz sortutakoa.

Espainiar estatuan "Nolotil" izena komertzialarekin dago salgai, besteak beste.

Kanpo estekak[aldatu | aldatu iturburu kodea]


Medikuntza Artikulu hau medikuntzari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.