Tagatosa

Wikipedia, Entziklopedia askea
Tagatosa
Tagatose.png
Formula kimikoa C₆H₁₂O₆
SMILES kanonikoa 2D eredua
SMILES isomerikoa
C([C@H]([C@@H]([C@@H](C(=O)CO)O)O)O)O
InChl 3D eredua
Osatuta oxigeno, karbono eta hidrogeno
Tautomeroa D-tagatopyranose (en) Itzuli
Ezaugarriak
Fusio-puntua 135 °C
Masa molekularra 180,063 u
Erabilera
Rola iron chelating agent (en) Itzuli
Arriskuak
NFPA 704
NFPA 704.svg
0
0
0
Identifikatzaileak
InChlKey BJHIKXHVCXFQLS-PQLUHFTBSA-N
CAS zenbakia 87-81-0
ChemSpider 83142
PubChem 92092
Reaxys 1724555
Gmelin 47693
EC zenbakia 201-772-3
ECHA 100.001.612
MeSH C030192
UNII T7A20Y888Y
PDB Ligand TAG

Tagatosa formula duen monosakaridoa da, zetona taldea (C=O) bigarren karbonoan duena. Sei karbono dituenez hexosa bat da.

Ezaugarriak[aldatu | aldatu iturburu kodea]

Sakarosaren gozotasunaren %92a dauka baina kalorien %38a baino ez.

Erabilerak[aldatu | aldatu iturburu kodea]

Indize gluzemiko oso txikia du. Konparazio batera sakarosaren indizea 68 da, fruktosarena 24 eta tagatosarena 3. Horrek diabetikoentzako azukre egokia bihurtzen du[1] eta edulkoratzaile gisa erabiltzen da.

Pisua jeisteko balio izateaz gain antioxidatzaile eraginkorra dela ere frogatu da.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Portal Diabetes.net. 2008-05-05 . Noiz kontsultatua: 2018-11-03.


Kanpo estekak[aldatu | aldatu iturburu kodea]