Zitidina

Wikipedia, Entziklopedia askea
Zitidina
Cytidin.svg
Formula kimikoaC9H13N3O5
SMILES kanonikoa2D eredua
SMILES isomerikoa
Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1
InChl3D eredua
Osatutaoxigeno eta karbono
Masa molekularra243,085521 Da
Identifikatzaileak
InChlKeyUHDGCWIWMRVCDJ-XVFCMESISA-N
CAS zenbakia65-46-3
ChemSpider5940
PubChem6175
Reaxys89173
Gmelin17562
ChEBI84763
ChEMBLCHEMBL78 eta CHEMBL95606
EC zenbakia200-610-9
ECHA100.000.555
CosIng55574
MeSHD003562
Human Metabolome DatabaseHMDB0000089
UNII5CSZ8459RP
KEGGC00475
PDB LigandCTN

Zitidina zitosina base nitrogenatuak eta erribosa azukreak osatzen duten nukleosido bat da.

Zitosina desoxirribosa bati lotzen zaionean, desoxizitidina nukleosidoa sortzen da. Era berean, fosforilatzen denean nukleotido bat sortzen du zitidinak, CMP (zitidina monofosfatoa), RNAn dagoena (desoxizitidina monofosfatoa DNAn dagoen nukleotidoa izanik).

Bere pisu molekularra 243,22 daltonekoa da eta bere urtze-puntua 230 °Ckoa.

Nukleosido hau disolbagarria da uretan, baina etanolean pixka bat besterik ez.

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.