Anteraxantina
Appearance
Anteraxantina | |
---|---|
![]() | |
Formula kimikoa | C40H56O3 |
SMILES kanonikoa | 2D eredua |
SMILES isomerikoa | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@]23[C@](O2)(C[C@H](CC3(C)C)O)C)/C)/C |
MolView | 3D eredua |
Mota | [[(3S)-6-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol|(3S)-6-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol]] (en) ![]() |
Estereoisomeroa | [[(1R,3S,6S)-6-[(1E,3Z,5E,7E,9E,11E,13E,15Z,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol|(1R,3S,6S)-6-[(1E,3Z,5E,7E,9E,11E,13E,15Z,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol]] (en) ![]() ![]() ![]() ![]() |
Masa molekularra | 584,422946 Da |
Erabilera | |
Rola | primary metabolite (en) ![]() |
Identifikatzaileak | |
InChlKey | OFNSUWBAQRCHAV-OYQUVCAXSA-N |
CAS zenbakia | 640-03-9 |
ChemSpider | 4444635 |
PubChem | 5281223 |
Reaxys | 101042 |
Gmelin | 27867 |
KNApSAcK | C00003760 |
UNII | 0306J2L3DV |
KEGG | C08579 |
Anteraxantina xantofila mota bat da, kolore hori bizia duen pigmentua da.
Izena
[aldatu | aldatu iturburu kodea]Grekerazko ánthos ("lorea") eta xanthos ("horia") hitzen elkarketatik dator anteraxantina izena.
Funtzioak
[aldatu | aldatu iturburu kodea]Kloroplastoetako tilakoideen mintzetan kokatzen da eta xantofiloen zikloaren bitartekari bat da. Loreak deigarri bihurtzeko funtzio du, algatan ordea fotoprotekzioa du helburu[1][2].
![](http://upload.wikimedia.org/wikipedia/commons/thumb/4/4f/DandelionFlower.jpg/250px-DandelionFlower.jpg)
Erreferentziak
[aldatu | aldatu iturburu kodea]- ↑ Duan S., Bianchi T.. (2006). Seasonal changes in the abundance and composition of plant pigments in particulate organic carbon in the lower Mississippi and Pearl Rivers.. Estuaries and Coasts 29, 427-442 or..
- ↑ Yamamoto HY. (1979). Biochemistry of the violaxanthin cycle in higher plants.. Pure Applied Chemistry 51, 639–648 or..