Edukira joan

Netilmizina

Wikipedia, Entziklopedia askea
Netilmizina
Formula kimikoaC21H41N5O7
SMILES kanonikoa2D eredua
SMILES isomerikoa
CCN[C@@H]1C[C@H](N)[C@@H](O[C@H]2OC(CN)=CC[C@H]2N)[C@H](O)[C@H]1O[C@H]3OC[C@](C)(O)[C@H](NC)[C@H]3O
MolView3D eredua
Motaaminoglycoside (en) Itzuli
Masa molekularra475,300598652 Da
Erabilera
Rolaprotein synthesis inhibitor (en) Itzuli eta Bakterio-kontrako
Identifikatzaileak
InChlKeyCIDUJQMULVCIBT-MQDUPKMGSA-N
CAS zenbakia56391-56-1
ChemSpider38195
PubChem441306
Gmelin7528
ChEMBLCHEMBL1572
EC zenbakia260-146-8
ECHA100.054.661
MeSHD009428
RxNorm7337
UNII4O5J85GJJB
NDF-RTN0000147943
KEGGD08268

Netilmizina aminoglikosidoen familiako antibiotikoa da, bakterio askoren aurka erabiltzen dutena. Gernu-infekzioa edo infekzio sistemiko potentzialki hilgarria duten eta giltzurrun-funtzio normala duten pazienteentzat da egokia netilmizina. Antbiotiko hau ototoxikoa da.[1]

Erreferentziak[aldatu | aldatu iturburu kodea]

Kanpo estekak[aldatu | aldatu iturburu kodea]