Betanina

Wikipedia, Entziklopedia askea
Betanina
Betanin.svg
Formula kimikoa C24H27N2O13
SMILES kanonikoa 2D eredua
SMILES isomerikoa
c1c2c(cc(c1O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)N([C@@H](C2)C(=O)O)/C=C/C4=CC(=N[C@@H](C4)C(=O)O)C(=O)O
InChl 3D eredua
Identifikatzaileak
InChlKey DHHFDKNIEVKVKS-FMOSSLLZSA-N eta CTMLKIKAUFEMLE-FTNGGYTGSA-N
CAS zenbakia 7659-95-2
ChemSpider 21106496
PubChem 11953901
Gmelin 3080
EC zenbakia 231-628-5
ECHA 100.028.753
CosIng 32170
UNII 5YJC992ZP6

Betanina[1] elikagai koloragarri arrosa da, elikagaien industrian (non E-162 kodea duen) gehigarri bezala erabiltzen dutena . Beta vulgaris landaretik aterata, bere koloreak pHren arabera aldatzen du.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Euskalterm: [Kontsulta-fitxak] [2002]

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.