Desoxizitidina

Wikipedia, Entziklopedia askea
Desoxizitidina
Desoxycytidin.svg
Formula kimikoaC9H13N3O4
SMILES kanonikoa2D eredua
SMILES isomerikoa
c1cn(c(=O)nc1N)[C@H]2C[C@@H]([C@H](O2)CO)O
InChl3D eredua
Osatutaoxigeno eta karbono
Masa molekularra227,217 Da
Identifikatzaileak
InChlKeyCKTSBUTUHBMZGZ-SHYZEUOFSA-N
CAS zenbakia951-77-9
ChemSpider13117
PubChem13711
Reaxys87567
Gmelin15698
ChEBI1321747
ChEMBLCHEMBL66115
EC zenbakia213-454-1
ECHA100.012.231
CosIng96738
MeSHD003841
Human Metabolome DatabaseHMDB0000014
UNII0W860991D6
KEGGC00881
PDB LigandDCZ

Desoxizitidina desoxirribonukleosido bat da, azido desoxirrinonukleikoaren (DNA) osagaia. Zitidina erribonukleosidoaren antzeko egitura du, hidroxilo-talde bat gutxiagorekin, 2' posizioan. Desoxizitidina dCK entzimak (desoxizitidina kinasa) fosforilatu dezake.