Dezitabina

Wikipedia, Entziklopedia askea
Dezitabina
Decitabine.svg
Formula kimikoaC8H12N4O4
SMILES kanonikoa2D eredua
SMILES isomerikoa
C1[C@@H]([C@H](O[C@H]1N2C=NC(=NC2=O)N)CO)O
InChl3D eredua
Masa molekularra228,085855 Da
Erabilera
Konposatu aktiboaDacogen (en) Itzuli
Tratatzen duacute myeloid leukemia (en) Itzuli eta myelodysplastic syndrome (en) Itzuli
RolaDNA polymerase inhibitors (en) Itzuli, Entzimen inhibitzaile, antineoplastic antimetabolites (en) Itzuli eta Teratogen (en) Itzuli
Identifikatzaileak
InChlKeyXAUDJQYHKZQPEU-KVQBGUIXSA-N
CAS zenbakia2353-33-5
ChemSpider397844
PubChem451668
Reaxys617982
Gmelin50131
ChEMBLCHEMBL1201129
EC zenbakia219-089-4
ECHA100.017.355
MeSHD000077209
RxNorm15657
UNII776B62CQ27
NDF-RTN0000175993
KEGGD03665

Dezitabina (komertzialki Dacogen) edo 5-aza-2'-desoxizitidina azido nukleikoen sintesi-inhibitzailea da.[1] Sindrome mielodisplasikoen tratamendurako sendagaia da, bai eta leuzemia mieloide akutuaren aurka ere (LMA).[2] Kimikoki, zitidinaren analogoa da.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. (Ingelesez) PubChem. «Decitabine» pubchem.ncbi.nlm.nih.gov (Noiz kontsultatua: 2020-02-12).
  2. (Ingelesez) «EC Approves Marketing Authorization Of DACOGEN For Acute Myeloid Leukemia» RTTNews (Noiz kontsultatua: 2020-02-12).