Edukira joan

Espektinomizina

Wikipedia, Entziklopedia askea
Espektinomizina
Formula kimikoaC14H24N2O7
SMILES kanonikoa2D eredua
SMILES isomerikoa
C[C@@H]1CC(=O)[C@]2([C@@H](O1)O[C@@H]3[C@H]([C@@H]([C@@H]([C@@H]([C@H]3O2)NC)O)NC)O)O
MolView3D eredua
Mota[[(5R,8R,11S,12S,13R,14S)-8,12,14-trihydroxy-5-methyl-11,13-bis(methylamino)-2,4,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-one|(5R,8R,11S,12S,13R,14S)-8,12,14-trihydroxy-5-methyl-11,13-bis(methylamino)-2,4,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-one]] (en) Itzuli
Masa molekularra332,158 Da
Erabilera
Tratatzen duGonorrea
HaurdunaldiaUS pregnancy category B (en) Itzuli
Rolaprotein synthesis inhibitor (en) Itzuli, Bakterio-kontrako, farmako esentzial eta Bakterizida
Identifikatzaileak
InChlKeyUNFWWIHTNXNPBV-WXKVUWSESA-N
CAS zenbakia1695-77-8
ChemSpider14785
PubChem15541
Reaxys2171701
Gmelin9215
ChEMBLCHEMBL1167
EC zenbakia216-911-3
ECHA100.015.374
MeSHD000198
RxNorm270
Human Metabolome DatabaseHMDB0015055
UNII93AKI1U6QF
NDF-RTN0000148017
KEGGC02078 eta D08526
PDB LigandSCM
Ohar medikoa
Ohar medikoa
Oharra: Wikipediak ez du mediku aholkurik ematen. Tratamendua behar duzula uste baduzu, jo ezazu sendagilearengana.

Espektinomizina[1] antibiotiko bakteriostatiko bat da, aminoglikosidoen familiatik eratorria. 1962an aurkitu zuten Streptomyces spectabilis bakterian. Bere egitura molekularra, aminoziklitolezko eraztun batean oinarritzen da. Ez da nefrotoxikoa, ezta ototoxikoa ere.[2]

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Eusko Jaurlaritza. Animalietan eta haien produktuetan egon daitezkeen hondakinak ikertzeko EAEko planaren ebaluazioa; 2013. eta 2014. urteak. .
  2. Navas Elorza, E. (2002). «Tetraciclinas, fenicoles, lincosamidas, polimixinas, espectinomicina, fosfomicina» Medicine 08 (70): 3763 - 3770..

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.