Piperina

Wikipedia, Entziklopedia askea
Piperina
Piperin.svg
Piperine crystals.jpg
Formula kimikoaC17H19NO3
SMILES kanonikoa2D eredua
SMILES isomerikoa
C1CCN(CC1)C(=O)/C=C/C=C/C2=CC3=C(C=C2)OCO3
InChl3D eredua
Osatutanitrogeno, karbono, oxigeno eta hidrogeno
Motabenzodioxoles (en) Itzuli
Ezaugarriak
Fusio-puntua131 °C
Masa molekularra285,136 Da
Erabilera
ElkarrekintzaTransient receptor potential cation channel subfamily V member 1 (en) Itzuli
RolaCytochrome P-450 Enzyme Inhibitors (en) Itzuli
Identifikatzaileak
InChlKeyMXXWOMGUGJBKIW-YPCIICBESA-N
CAS zenbakia94-62-2
ChemSpider553590
PubChem638024
Reaxys90741
Gmelin28821
ChEBI341351
ChEMBLCHEMBL43185
EC zenbakia202-348-0
ECHA100.002.135
CosIng40915
MeSHC008922
RxNorm1311146
Human Metabolome DatabaseHMDB0029377
KNApSAcKC00002065
UNIIU71XL721QK
KEGGC03882
PDB LigandAYR

Piperina piperminetik eta piperazeoen familiako beste landareetatik ateratzen den alkaloidea da. Sukarraren eta sabeleko gorabeheren kontrako sendagai gisa erabiltzen zen.

Erreferentziak[aldatu | aldatu iturburu kodea]

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.