Kaltzitriol

Wikipedia, Entziklopedia askea
Kaltzitriol
Calcitriol2.svg
Formula kimikoaC27H44O3
SMILES kanonikoa2D eredua
SMILES isomerikoa
C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](C[C@@H](C3=C)O)O)C
InChl3D eredua
Osatutakarbono
MotaD3 vitamins (en) Itzuli
Masa molekularra416,329 Da
Erabilera
Konposatu aktiboaVectical (en) Itzuli eta Rocaltrol (en) Itzuli
Tratatzen duacropustulosis (en) Itzuli, hiperparatiroidismo eta Errakitismo
Elkarrekintzavitamin D receptor (en) Itzuli
HaurdunaldiaAustralian pregnancy category B3 (en) Itzuli eta US pregnancy category C (en) Itzuli
Rolaantipsoriatic (en) Itzuli, bone density conservation agents (en) Itzuli, Bitamina eta Calcium Channel Agonists (en) Itzuli
Identifikatzaileak
InChlKeyGMRQFYUYWCNGIN-NKMMMXOESA-N
CAS zenbakia32222-06-3
ChemSpider4444108
PubChem5280453
Reaxys2227647
Gmelin17823
ChEMBLCHEMBL846
RTECS zenbakiaFZ4645000
DSSTox zenbakiaFZ4645000
EC zenbakia250-963-8
ECHA100.046.315
MeSHD002117
RxNorm1894
Human Metabolome DatabaseHMDB0001903
UNIIFXC9231JVH
NDF-RTN0000146161
KEGGD00129
PDB LigandVDX

Kaltzitriola edo 1-alfa,25-dihidroxikolekaltziferola (1,25-(OH)2D3 laburtua) D bitaminaren forma aktiboa da, giltzurrunean sortua.[1] Kolekaltziferola, gibelean hidroxilazio bidez, 25-hidroxikolekaltziferol (kaltzidiola) bihurtzen da. Hau, berriz ere, giltzurrunean hidroxilatzen denean, kaltzitriola sortzen du.[2] Kaltzitriolak kaltzioaren kontzentrazio plasmatikoa erregulatzen du, traktu gastrointestinalean kaltzioaren xurgapena areagotzea eragiten baitu.[3]

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. (Ingelesez) Encyclopedia of Endocrine Diseases. Academic Press, 344 or. ISBN 9780128122006..
  2. «D bitamina helduengan: gainbaloratuta dago?» NFAC: 2..
  3. (Gaztelaniaz) Henry, John B. (1988). Todd-Sandford ed. Diagnóstico y tratamiento clínicos por el laboratorio. (8. argitaraldia) Salvat, 182-197 or. ISBN 84-345-587-9..

Kanpo estekak[aldatu | aldatu iturburu kodea]


Medikuntza Artikulu hau medikuntzari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.