Karnitina

Wikipedia, Entziklopedia askea
Karnitina
Carnitine structure.png
Formula kimikoaC7H15NO3
SMILES kanonikoa[N+(C)(C)CC(CC(=O)[O-])O&zoom=2.0&annotate=none 2D eredua]
SMILES isomerikoa
C[N+](C)(C)C[C@H](O)CC([O-])=O
MolView[N+(C)(C)CC(CC(=O)[O-])O 3D eredua]
Konposizioakarbono eta L-carnitine (en) Itzuli
Azido konjokatuacarnitinium (en) Itzuli
Masa molekularra161,105193 Da
Erabilera
HaurdunaldiaUS pregnancy category B (en) Itzuli
Identifikatzaileak
InChlKeyPHIQHXFUZVPYII-UHFFFAOYSA-N
CAS zenbakia406-76-8
ChemSpider282
PubChem288
Reaxys1866665
Gmelin17126
ChEMBLCHEMBL172513
EC zenbakia206-976-6
ECHA100.006.343
MeSHD002331
RxNorm2106
UNIIS7UI8SM58A
NDF-RTN0000148430
KEGGC00318

Karnitina edo 3-hidroxi-4-trimetilaminobutiratoa (L-karnitina edo lebokarnitina ere esaten zaio, egoera naturalean L estereoisomeroa gehien bat aurkitzen delako) gibelean, giltzurrunetan eta garunean sintetizatutako amina kuaternarioa da, bi aminoazido esentzialetatik abiatuta: lisinatik eta metioninatik.

Funtzioa[aldatu | aldatu iturburu kodea]

Eukariotoetan, karnitina arduratzen da gantz-azidoak mitokondrioen barrualdera garraiatzeaz, β-oxidazioa gerta dadin energia ATP moduan sortzeko. Karnitina arduratzen da azilo-taldeak matrize mitonkondrialaren barrura eramateaz, mekanismo honen bidez:

  1. Karnitina aziltransferasa I entzimak, kanpoko mintz mitokondrialean kokatua, azil-CoA molekularen koentzima A (CoA) askatzen du eta, aldi berean, mintzarteko espazioan dagoen karnitina lotzen du, azilkarnitina sortuz. CoA aske geratzen da eta zitosolera irten daiteke beste gantz-azido bat aktibatzeko.
  2. Ondoren, proteina garraiatzaile batek, karnitina-azilkarnitina translokasa izenekoa, barneko mintz mitokondrialean kokatua, azilkarnitina matrize mitonkondrialera transferitzen du, non karnitina aziltransferasa II entzimak karnitina askatzen du eta gantz-azidoari CoA molekula bat lotzen dio.
  3. Karnitina mintzaren arteko espaziora itzultzen da translokasaren bidez, eta beste azil-CoA batekin erreakzionatu dezake berriro, zikloa errepikatuz.


Kanpo estekak[aldatu | aldatu iturburu kodea]