Etanbutol

Wikipedia, Entziklopedia askea
Etanbutol
Ethambutol.svg
Formula kimikoa C10H24N2O2
SMILES kanonikoa 2D eredua
SMILES isomerikoa
CC[C@@H](CO)NCCN[C@@H](CC)CO
InChl 3D eredua
Mota Bakterizida eta antituberculous drug (en) Itzuli
Masa molekularra 204,183778 u
Erabilera
Konposatu aktiboa Myambutol (en) Itzuli
Tratatzen du tuberkulosi, pulmonary tuberculosis (en) Itzuli eta Mycobacterium avium-intracellulare infection (en) Itzuli
Haurdunaldia US pregnancy category C (en) Itzuli
Rola DNA polymerase inhibitors (en) Itzuli eta antituberculous drug (en) Itzuli
Identifikatzaileak
InChlKey AEUTYOVWOVBAKS-UWVGGRQHSA-N
CAS zenbakia 74-55-5
ChemSpider 13433
PubChem 14052
Reaxys 6312870
Gmelin 4877
ChEMBL CHEMBL44884
EC zenbakia 200-810-6
ECHA 100.000.737
MeSH D004977
RxNorm 4110
UNII 8G167061QZ
NDF-RT N0000147838
KEGG C06984 eta D07925
PDB Ligand 95E
Ohar medikoa
Oharra: Wikipediak ez du mediku aholkurik ematen. Tratamendua behar duzula uste baduzu, jo ezazu sendagilearengana.

Etanbutola antibiotiko hidrosolublea eta termoegonkorra da. 1961ean sintetizatu zuten lehen aldiz. Mikobakterioak eragindako infekzioak tratatzeko erabiltzen den farmakoa da, tuberkulosia[1] eta mikobakterio atipikoek eragindako infekzioak barne.

Lehen mailako erresistentzia-tasa handiagoa duten lekuetatiko pazienteengan (ekialdeko Europa, Latinoamerika, Afrika eta Asia) erabiltzen dute. Badaezpada, ez da komeni ume txikiengan etanbutola erabiltzea, begi-toxikotasuna ebaluatzea zaila delako.[2]

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Etorkin Helduaren Osasun Laguntzarako Gomendioak. Eusko Jaurlaritza / Osasun Saila 2008ko Urtarrila, 23 or..
  2. Tuberkulosia prebenitzeko eta kontrolatzeko programa. Eusko Jaurlaritza / Osasun Saila 2001eko maiatza, 23 eta 27 or..

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.