Edukira joan

«B2 bitamina»: berrikuspenen arteko aldeak

1.842 bytes removed ,  Duela 2 urte
ez dago edizio laburpenik
No edit summary
Etiketa: 2017 wikitestu editorearekin
{{konposatu kimiko infotaula}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 458451303
| ImageFile = Riboflavin_structure.svg
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Formula
| ImageFileL1 = Riboflavin-3d.png
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageNameL1 = Modelo
| ImageFileR1 = Riboflavin powder.jpg
| ImageNameR1 = Hautsa
| IUPACName = 7,8-Dimetil-10-[(2''S'',3''S'',4''R'')-2,3,4,5-tetrahidroxipentil]bentzo[''g'']pteridina-2,4-diona<ref>PubChem 493570</ref>
| Section1 = {{Chembox Identifiers
| CASNo = 83-88-5
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 493570
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}}
| ChemSpiderID = 431981
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 201-507-1
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TLM2976OFR
| DrugBank = DB00140
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = D00050
| KEGG_Ref = {{keggcite|changed|kegg}}
| MeSHName = Riboflavin
| ChEBI = 17015
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 511565
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ATCCode_prefix = A11
| ATCCode_suffix = HA04
| Beilstein = 97825
| 3DMet = B01201
| SMILES = O=C2/N=C\1/N(c3cc(c(cc3/N=C/1C(=O)N2)C)C)C[C@H](O)[C@H](O)[C@H](O)CO
| StdInChI = InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = AUNGANRZJHBGPY-SCRDCRAPSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
| Section2 = {{Chembox Properties
| C=17|H=20|N=4|O=6
| ExactMass = 376.138284392 g mol<sup>-1</sup>
| Appearance = Kristal laranjak
| LogP = 0.095
| pKa = 9.888
| pKb = 4.109
}}
| Section3 = {{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R = 0
}}
}}
 
'''B2 bitamina''' edo '''erriboflabina''' [[kolore hori]]dun [[bitamina]] hidrosolugarria da. Bere egituran [[isoaloxazina]] eraztun konplexu bati [[erribitol]] talde bat lotzen zaio, [[erribosa]]tik eratorritako [[alkohol]] bat.