Akonitina

Wikipedia, Entziklopedia askea
Akonitina
Aconitine.svg
Formula kimikoaC34H47NO11
SMILES kanonikoa2D eredua
SMILES isomerikoa
CCN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H](C31)[C@@]5([C@@H]6[C@H]4C[C@@]([C@@H]6OC(=O)C7=CC=CC=C7)([C@H]([C@@H]5O)OC)O)OC(=O)C)OC)OC)O)COC
InChl3D eredua
Osatutanitrogeno eta karbono
Zeren produktuaAconitum
Motakonposatu kimiko eta aconitane alkaloid (en) Itzuli
Masa molekularra645,314911 Da
Erabilera
Rolaimmunologic adjuvant (en) Itzuli eta Voltage-Gated Sodium Channel Agonists (en) Itzuli
Identifikatzaileak
InChlKeyXFSBVAOIAHNAPC-XTHSEXKGSA-N
CAS zenbakia302-27-2
ChemSpider214292
PubChem245005
Reaxys74608
Gmelin2430
ChEMBLCHEMBL1979562
RTECS zenbakiaAR5960000
ZVG510021
DSSTox zenbakiaAR5960000
EC zenbakia206-121-7
ECHA100.005.566
MeSHD000157
KNApSAcKC00001611
UNIIX8YN71D5WC
KEGGC06091

Akonitina irabelarraren hostoetan eta sustraietan dagoen alkaloide oso pozoitsua da, antzinatik ezaguna. Arnas giharrak geldiarazten ditu, eta heriotza ekartzen oso denbora gutxian.[1]

Lehen antipiretiko eta analgesiko moduan erabiltzen zuten, dosia ondo neurtzea zaila zen arren.[2]

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Lur entziklopedietatik hartua.
  2. Chan, TY. (2009). «Aconite poisoning» Clinical Toxicology 47 (4): 279–285. doi:10.1080/15563650902904407. PMID 19514874..

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.