Akonitina

Wikipedia, Entziklopedia askea
Akonitina
Aconitine new.png
Formula kimikoa C₃₄H₄₇NO₁₁
SMILES kanonikoa 2D eredua
SMILES isomerikoa
CCN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H](C31)[C@@]5([C@@H]6[C@H]4C[C@@]([C@@H]6OC(=O)C7=CC=CC=C7)([C@H]([C@@H]5O)OC)O)OC(=O)C)OC)OC)O)COC
InChl 3D eredua
Osatuta nitrogeno eta karbono
Masa molekularra 645,314911 u
Erabilera
Rola immunologic adjuvant (en) Itzuli eta Voltage-Gated Sodium Channel Agonists (en) Itzuli
Identifikatzaileak
InChlKey XFSBVAOIAHNAPC-XTHSEXKGSA-N
CAS zenbakia 302-27-2
ChemSpider 214292
PubChem 245005
Reaxys 74608
Gmelin 2430
ChEMBL CHEMBL1979562
RTECS zenbakia AR5960000
ZVG 510021
DSSTox zenbakia AR5960000
EC zenbakia 206-121-7
ECHA 100.005.566
MeSH D000157
KNApSAcK C00001611
UNII X8YN71D5WC
KEGG C06091

Akonitina irabelarraren hostoetan eta sustraietan dagoen alkaloide oso pozoitsua da, antzinatik ezaguna. Arnas giharrak geldiarazten ditu, eta heriotza ekartzen oso denbora gutxian.[1]

Lehen antipiretiko eta analgesiko moduan erabiltzen zuten, dosia ondo neurtzea zaila zen arren.[2]

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Lur entziklopedietatik hartua.
  2. Chan, TY. (2009). «Aconite poisoning» Clinical Toxicology 47 (4): 279–285 doi:10.1080/15563650902904407 PMID 19514874.

Kanpo estekak[aldatu | aldatu iturburu kodea]


Kimika Artikulu hau kimikari buruzko zirriborroa da. Wikipedia lagun dezakezu edukia osatuz.