Galaktosamina

Wikipedia, Entziklopedia askea
Galaktosamina
Formula kimikoaC6H13NO5
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)N)O)O)O
InChl3D eredua
Motakonposatu kimiko
Masa molekularra179,079 Da
Identifikatzaileak
InChlKeyMSWZFWKMSRAUBD-GASJEMHNSA-N
CAS zenbakia7535-00-4
ChemSpider22576
PubChem24154
Reaxys2042269
Gmelin60312
ChEMBLCHEMBL3304228
KEGGC02262

Galaktosamina () galaktosaren deribatua den aminoazukre bat da.

Ezaugarriak[aldatu | aldatu iturburu kodea]

Galaktosaren bigarren karbonoko hidroxilo taldea (-OH) amina talde batek (-NH2) ordezkatu du.

Garrantzia biologikoa[aldatu | aldatu iturburu kodea]

Hainbat hormona glukoproteikoren osagaia da, Hormona folikulu estimulatzailearena (FSH) eta Hormona luteinizatzailearena (LH) esate baterako.

Molekula hepatotoxikoa ere bada, hau da, gibeleko zelulak kaltetzen ditu.

Erreferentziak[aldatu | aldatu iturburu kodea]

Kanpo estekak[aldatu | aldatu iturburu kodea]