Glukosamina

Wikipedia, Entziklopedia askea
Glukosamina
Alpha-D-glucosamine.png
Formula kimikoaC6H13NO5
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)O
InChl3D eredua
Osatutaoxigeno, karbono, nitrogeno eta hidrogeno
Motaglucosamine (en) Itzuli eta konposatu kimiko
Masa molekularra179,079373 Da
Erabilera
Tratatzen duArtrosi
Identifikatzaileak
InChlKeyMSWZFWKMSRAUBD-IVMDWMLBSA-N
CAS zenbakia3416-24-8
ChemSpider388352
PubChem439213
Reaxys1423209
Gmelin47977
ChEBI397125
ChEMBLCHEMBL493287
EC zenbakia222-311-2
ECHA100.020.284
CosIng34010
MeSHD005944
RxNorm4845
Human Metabolome DatabaseHMDB0001514
UNIIN08U5BOQ1K
NDF-RTN0000148778
KEGGD04334

Glukosamina () glukosaren deribatu bat den aminoazukre bat da. Existitzen den monosakarido ugarienetako bat da[1].

Ezaugarriak[aldatu | aldatu iturburu kodea]

Glukosaren bigarren karbonoko hidroxilo taldea (-OH) amina talde batek (-NH2) ordezkatu du.

Garrantzia biologikoa[aldatu | aldatu iturburu kodea]

Animalien hezurretan eta animalia itsastarren oskoletan oso ugaria da.

Glukosamina polimerizatzerakoan kitosanoa izeneko polisakaridoa eratzen du. Bestalde amino taldea azetilatzen zaionean N-Azetilglukosamina bihurtzen da eta hau polimerizatzean Kitina izeneko polisakaridoa eratzen da, naturan dagoen bigarren polisakarido ugariena, izan ere kitina artropodoen exoeskeletoaren eta onddoen pareta zelularraren osagaia nagusia baita.

Erabilerak[aldatu | aldatu iturburu kodea]

Artritisaren eta Artrosiaren tratamenduan erabiltzen da[2]. Glukosamina glikosaminoglukanoen eta proteoglikanoen aurrekaria da eta honekin kartilago ehuna garatzen laguntzen du[3].

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. The Carbohydrates. Academic Press, 727–728 or. ISBN 9780125563512..
  2. (Ingelesez) «Glucosamine Sulfate: MedlinePlus Supplements» medlineplus.gov (Noiz kontsultatua: 2018-11-04).
  3. (Ingelesez) Eraslan, Ali; Ulkar, Bulent. (2015-01-02). «Glucosamine Supplementation after Anterior Cruciate Ligament Reconstruction in Athletes: A Randomized Placebo-controlled Trial» Research in Sports Medicine 23 (1): 14–26. doi:10.1080/15438627.2014.975809. ISSN 1543-8627. (Noiz kontsultatua: 2018-11-04).

Kanpo estekak[aldatu | aldatu iturburu kodea]