Zelobiosa

Wikipedia, Entziklopedia askea
Zelobiosa
Cellulose-2D-skeletal.svg
Formula kimikoaC12H22O11
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](OC([C@@H]([C@H]2O)O)O)CO)O)O)O)O
InChl3D eredua
Osatutaoxigeno, karbono eta hidrogeno
Mota[[hexopyranosyl-(1->4)-hexopyranose|hexopyranosyl-(1->4)-hexopyranose]] (en) Itzuli
Masa molekularra342,116212 Da
Arriskuak
NFPA 704
NFPA 704.svg
0
1
0
Identifikatzaileak
InChlKeyGUBGYTABKSRVRQ-CUHNMECISA-N
CAS zenbakia528-50-7
ChemSpider388323
PubChem439178
Reaxys1292744
Gmelin17057
ZVG104740
EC zenbakia208-436-5
ECHA100.007.670
MeSHD002475
Human Metabolome DatabaseHMDB0000055
KNApSAcKC00001134
UNIIBM3MOX055H
KEGGC00185

Zelobiosa zelulosa hidrolisatzerakoan sortzen den disakaridoa da. Bi glukosa molekulaz osaturik dago.

Egitura[aldatu | aldatu iturburu kodea]

Zelobiosaren formula enpirikoa da. Lehen glukosako lehenengo karbonoaren eta bigarren glukosako laugarren karbonoaren artean sortzen da β(1→4) lotura O-glikosidikoa. Lotura hori osatzerakoan ura askatzen da eta oxigeno monokarboniliko batek zubi-lana egiten du bi molekulen artean. Bigarren glukosaren karbono anomerikoan dagoen hidroxilo taldea aske dagoenez ahalmen erreduzitzailea duen azukrea da. Horrela beraz zelobiosaren izen sistematikoa honako hau da:

β-D-glukopiranosil-(1→4)-β-D-glukopiranosa

Zelobiosak zortzi hidroxilo talde aske ditu eta horri esker hidrogeno loturak era ditzake eta sare egitura sendoa sortu. Anhidrido azetikoarekin eta aido sulfurikoarekin tratatuz gero Zelobiosa oktoazetatoa lortzen da, disolbatzaile ezpolar organikotan disolbatzeko gai dena[1].

Historia[aldatu | aldatu iturburu kodea]

Zdenko Hans Skraup kimikari txekiarrak deskribatu zuen lehen aldiz, 1901 urtean[2].

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. (Ingelesez) «http://orgsyn.org/demo.aspx?prep=CV2P0124» orgsyn.org (Noiz kontsultatua: 2018-11-11).
  2. (Alemanez) Skraup, Zd. H.; K�nig, J.. (1901-09). [https://link.springer.com/article/10.1007/BF01530313 «�ber die Cellobiose»] Monatshefte f�r Chemie 22 (9): 1011–1036. doi:10.1007/bf01530313. ISSN 0026-9247. (Noiz kontsultatua: 2018-11-11).

Kanpo estekak[aldatu | aldatu iturburu kodea]