Azido glukoniko

Wikipedia, Entziklopedia askea
Azido glukoniko
D-Gluconsäure Fischer.svg
Formula kimikoaC6H12O7
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O
InChl3D eredua
Osatutaoxigeno eta karbono
EstereoisomeroaL-gluconic acid (en) Itzuli
Ezaugarriak
Fusio-puntua131 °C
Masa molekularra196,058 Da
Identifikatzaileak
InChlKeyRGHNJXZEOKUKBD-SQOUGZDYSA-N
CAS zenbakia526-95-4
ChemSpider10240
PubChem10690
Reaxys1726055
Gmelin33198
ChEBI83545
ChEMBLCHEMBL464345
ZVG493175
EC zenbakia208-401-4
ECHA100.007.639
CosIng34008
RxNorm1808545
Human Metabolome DatabaseHMDB0000625
KNApSAcKC00007303
UNIIR4R8J0Q44B
NDF-RTN0000147263
KEGGC00257
PDB LigandGCO

Azido glukonikoa formula duen azido organikoa da.

Ezaugarriak[aldatu | aldatu iturburu kodea]

Glukosaren deribatu bat denez sei karbonotako kate bat da eta hidroxiloak hark bezala kokaturik ditu. Katearen muturrean ordea aldehidoa izan beharrean karboxilo talde bat du.

Ekoizpena[aldatu | aldatu iturburu kodea]

Bakterio batzuek (Acetobacter) eta lizun batzuek (Aspergillus eta Botrytis cinerea) hartzidura oxidatiboaren bidez ekoizten dute[1]. Glukosatik abiatuta katalasa entzimak sortzen du azido glukonikoa. Hartzidura gertatzeko oxigeno kopuru handia egon behar da uretan disolbatuta eta pH ia neutroa behar da.

Erabilerak[aldatu | aldatu iturburu kodea]

Mahatsarekin azido glukonikoaren portzentaia neurketak egiten dira alearen heldutasun maila determinatzeko eta ondorioz mahats-bilketa garaia abiatzeko[2].

Uretan disolbaturik dagoenean glukonato ioi bihurtzen da eta esterifikazio bidez glukonato gatzak eratzen dira. Sodio glukonatoa beirazko botilak garbitzeko erabiltzen da eta burdin glukonatoa anemiaren tratamendutan erabiltzen da.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. Nuria Cubero, Albert Monferrer, Jordi Villalta. (2008). Aditivos alimentarios. Mundi-Prensa Libros, 10 or..
  2. José Hidalgo Togores. (2001). Tratado de enología. , 1020 or..

Kanpo estekak[aldatu | aldatu iturburu kodea]