Xilulosa

Wikipedia, Entziklopedia askea
Xilulosa
Xylulose.png
Formula kimikoaC5H10O5
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@@H]([C@H](C(=O)CO)O)O)O
InChl3D eredua
Osatutaoxigeno, karbono eta hidrogeno
EstereoisomeroaD-xylulose (en) Itzuli
Masa molekularra150,052823 Da
Identifikatzaileak
InChlKeyZAQJHHRNXZUBTE-WVZVXSGGSA-N
CAS zenbakia527-50-4
ChemSpider20892
PubChem22253
Gmelin17399
MeSHD014996
Human Metabolome DatabaseHMDB0000751
UNIIDL1M07LQ7A
KEGGC00312

Xilulosa formula duen monosakaridoa da. Bost karbono dituen pentosa da eta bigarrenean karbonilo taldea duenez zetona bat da.

Ezaugarriak[aldatu | aldatu iturburu kodea]

Naturan D eta L-Xilulosak aurkitzen dira. Berezia da, izan ere monosakarido gehienek D enantiomeroa baino ez baitute agertzen.

Xilulosa ordea ez da oso ohikoa. Pentosuria gaixotasuna duten gaixoen gernuan ageri da.

Erreferentziak[aldatu | aldatu iturburu kodea]

Kanpo estekak[aldatu | aldatu iturburu kodea]