Kitina

Wikipedia, Entziklopedia askea
Kitina
Chitin.svg
Formula kimikoa(С8H13NO5)n
SMILES isomerikoa
N([C@@H]1[C@H](O[C@@H]([C@@H]([C@H]1O)O)CO)*O*[C@@H]1[C@@H](O)[C@H](NC(C)=O)[C@H](O[C@@H]1CO)*O*[C@@H]1[C@@H](O)[C@H](NC(C)=O)[C@H](O[C@@H]1CO)O)C(C)=O
Konposizioaoxigeno, karbono eta hidrogeno
Masa molekularra203,1925 g/mol
Identifikatzaileak
CAS zenbakia1398-61-4
PubChem6857375
Gmelin17029
EC zenbakia215-744-3
ECHA100.014.313
CosIng75063
MeSHD002686
Human Metabolome DatabaseHMDB0003362
UNII8SH93A7QWW
KEGGC00461

Kitina onddoen zelula horman eta artropodo batzuen kanpo-eskeletoan dagoen polisakaridoa da[1]. Zelulosaren ondoren naturan dagoen polimero ugariena da.

Etimologia eta historia[aldatu | aldatu iturburu kodea]

Kitina frantsesezko chitine hitzetik dator eta hau grekerazko χιτών izenetik. "Estalkia" edo "oskola" esan nahi du. Kitinaren egitura Albert Hofmann suitzarrak zehaztu zuen 1929 urtean.

Egitura[aldatu | aldatu iturburu kodea]

N-Azetilglukosaminaz osaturiko homopolisakaridoa da (zehazki, N-azetil-D glukosa-2 amina). Monomero horiek β(1→4) loturen bidez elkarturik daude (glukosa molekulek zelulosa osatzen duten modu berean)[2]. N-Azetilglukosaminaren disakaridoa kitobiosa da, eta hau ere har daiteke kitinaren monomero gisa.

Txitxarra larba garaian izan zuen kitinazko exoeskeletutik ateratzen.

α-kitina eta β-kitina existitzen dira. Naturan α-kitina da ohikoena, artropodo eta onddoen kutikuletan agertzen aita. β-kitina txibietan baino ez da aurkitu.

Kitina ez da uretan eta disolbatzaile organikoetan disolbatzen. Azido inorganikoetan (klorhidriko, sulfuriko...), baina, disolbagarria da, azetilo taldea galtzean kitosanoa bihurtzen baita.

Erabilerak[aldatu | aldatu iturburu kodea]

Karramarroen kanpo-eskeletotik erauzi ohi da, azidoak erabiliz. Aplikazio ugari ditu: eragile malutatzaile gisa uren tratamenduan, lodigarri moduan elikagai-industrian, industria farmazeutikoan, etab.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. McGavin, George C.. (2000). Insectos arañas y otros artrópodos terrestres. Barcelona Omega, 11 or. ISBN 84-282-1201-5..
  2. Hainbat autore. (2004). Biología molecular de la célula. Barcelona: Omega ISBN 978-84-282-1351-6..


Kanpo estekak[aldatu | aldatu iturburu kodea]