Azido hialuroniko

Wikipedia, Entziklopedia askea
Azido hialuroniko
Haworth projection of hyaluronan.svg
Formula kimikoaC28H44N2O23
SMILES isomerikoa
O=C(N[C@H]4[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]4O[C@@H]3O[C@H](C(=O)O)[C@@H](O[C@@H]2O[C@@H]([C@@H](O)[C@H](O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)[C@H]2NC(=O)C)CO)[C@H](O)[C@H]3O)C
InChl3D eredua
Osatutaoxigeno, karbono, nitrogeno eta hidrogeno
Motamukopolisakarido
Erabilera
Rolaimmunologic adjuvant (en) Itzuli eta Viscosupplements (en) Itzuli
Identifikatzaileak
InChlKeyKIUKXJAPPMFGSW-MNSSHETKSA-N
CAS zenbakia9004-61-9
ChemSpider2341172
PubChem24759
Reaxys8538277
Gmelin16336
EC zenbakia232-678-0
ECHA100.029.695
CosIng34315
MeSHD006820
Human Metabolome DatabaseHMDB0010366
UNIIS270N0TRQY
KEGGC00518

Azido hialuronikoa edo AH glikosaminglukano unitatez egindako polisakaridoa da. Gizakiaren larruazalean ugaria da baina beste hainbat tokitan ere agertzen da, humore beirakaran, zilborrestean, likido sinobialean, hezur-ehunean, bihotzeko balbuletan... 70 kilogramoko pisua duen gizaki batek batazbeste 15 gramo azido hialuroniko ditu eta egunero heren bat degradatu eta birsortzen da[1].

Historia[aldatu | aldatu iturburu kodea]

1934 urtean Karl Meyer eta John Palmer botikariek isolatu zuten azido hialuronikoa behien begietako humore beirakaran. Ikusi zuten osagaietako bat azido glukuronikoa zela eta hialoide hitzaren esanahia "berirakara" izanik, horregatik eman zioten hialuroniko izena.

Behien begietatik azido hialuronikoa ekoiztea teknikoki zaila zen baina 1942. urtean Endre Balazs hungariarrak teknika bera erabili zuen oilarren gandorrekin eta ordutik hau da ekoizpen industrialaren oinarriizko produktua. Endre Balazs berak egin zuen azidoaren lehen patentea, pastelgintzan arrautza zuringoaren ordezko gisa erabiltzeko.

Gaur egun oilarren gandorraz gain, marrazoen hegatsak, arrainen hondarrak, behien artikulazioak eta zilborresteak erabiltzen dira.

Egitura[aldatu | aldatu iturburu kodea]

Azido hialuronikoa glikosaminglukano unitatez egindako polisakaridoa da, eta hau aldi berean β (1→3) lotura duten azido glukuronikoaren eta N-Azetilglukosaminaren disakaridoen errepikapenez osatzen da. Espiralak osatzen dituzten makromolekula da, 50.000 disakarido inguru baititu. Ur kopuru handiak hartzeko gaitasuna du[1].

Erabilerak[aldatu | aldatu iturburu kodea]

Botika eraginkorra da zahartasunari aurre egiteko. Ur kopuru handiak gordetzen dituenez larruazalaren hezetasun maila mantentzen du. Kolagenoaren ekoizpena aktibatzen du fibroblastoen itxura aldatuz[2].

Zimurren aurkako krematan erabiltzen da beraz, bai eta zauri eta ultzerak orbaintzeko krematan ere. Kirurgia estetikoan ere betegarri gisa erabiltzen da, esate baterako ezpainetan eta masailetan[3].

Ehunak berreraikitzeko ere egokia da. Hainbat gaixotasunek larruazalari eragindako kalteak konpontzen ditu[4] eta artroskopietan galdu den likido sinobiala ordezkatzeko ere erabiltzen da[3].

Kirolariek ere asko erabiltzen dute, artikulazioak berrekuratzeko. Kanadan egindako esperimentu batean orkatiletan esgintzeak egindako kirolariak azido hialuronikoz tratatu zirenen %90a zortzi egunetan berriz entrenatzen hasi ziren, plazeboa jaso zutenen %71aren aurrean.

Inpaktu ekonomikoa[aldatu | aldatu iturburu kodea]

Kirurgia estetikoan erabiltzen denez garrantzi handia hartu du. 2004 urtean azido hialuronikoaren kilogramo batek 5.000 eurotako prezioa zeukan.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. a b Papakonstantinou, Eleni; Roth, Michael; Karakiulakis, George. (2012-07-01). «Hyaluronic acid: A key molecule in skin aging» Dermato-endocrinology 4 (3): 253–258. doi:10.4161/derm.21923. ISSN 1938-1972. PMID 23467280. PMC PMC3583886. (Noiz kontsultatua: 2018-11-17).
  2. Walker, Kendra; Pellegrini, Mark V.. (2018). «Hyaluronic Acid» StatPearls (StatPearls Publishing) PMID 29494047. (Noiz kontsultatua: 2018-11-17).
  3. a b «DICCIONARIO ILUSTRADO DE TÉRMINOS MEDICOS» www.iqb.es (Noiz kontsultatua: 2018-11-17).
  4. «- EL MUNDO | Suplemento salud 699 - El ácido hialurónico rellena las arrugas por partida doble» www.elmundo.es (Noiz kontsultatua: 2018-11-17).


Kanpo estekak[aldatu | aldatu iturburu kodea]