Sedoheptulosa

Wikipedia, Entziklopedia askea
Sedoheptulosa
Sedoheptulosa.png
Formula kimikoaC7H14O7
SMILES kanonikoa2D eredua
SMILES isomerikoa
C([C@H]([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O)O
InChl3D eredua
Osatutaoxigeno, karbono eta hidrogeno
Masa molekularra210,073978 Da
Identifikatzaileak
InChlKeyHSNZZMHEPUFJNZ-SHUUEZRQSA-N
CAS zenbakia3019-74-7
ChemSpider4573620
PubChem5459879
Gmelin16802
EC zenbakia221-166-2
ECHA100.019.243
KEGGC08355

Sedoheptulosa formula duen monosakaridoa da, zetona taldea (C=O) bigarren karbonoan duena. Zazpi karbono dituenez heptosa bat da.

Garrantzia biologikoa[aldatu | aldatu iturburu kodea]

Naturan existitzen diren heptosa bakanetako bat da. Pentosa fosfato bide metabolikoan berebiziko garrantzia du.


Kanpo estekak[aldatu | aldatu iturburu kodea]