Androsterona

Wikipedia, Entziklopedia askea
Androsterona
Androsterone.png
Formula kimikoaC19H30O2
SMILES kanonikoa2D eredua
SMILES isomerikoa
C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O
InChl3D eredua
Masa molekularra290,225 Da
Identifikatzaileak
InChlKeyQGXBDMJGAMFCBF-HLUDHZFRSA-N
CAS zenbakia53-41-8
ChemSpider5668
PubChem5879
Reaxys2217626
Gmelin16032
ChEBI700649
ChEMBLCHEMBL87285
EC zenbakia200-173-4
ECHA100.000.159
MeSHD000738
RxNorm1312359
Human Metabolome DatabaseHMDB0000031
UNIIC24W7J5D5R
KEGGC00523
PDB LigandAOI

Androsterona gizakiak berez sortzen duen sustantzia bat da, androgenoak ekoizteko bitartekaria dena. Egitura kimikoari dagokionez lipido esteroide bat da.

Jatorria[aldatu | aldatu iturburu kodea]

Animalietan agertzen da baina pinuaren polenean ere aurkitzen da.

Historia[aldatu | aldatu iturburu kodea]

Adolf Butenandtek aurkitu zuen 1931 urtean. Androsterona eta progesterona aurkitu izanagatik Kimikako Nobel Saria jaso zuen 1939an. Leopold Stephan Ruzicka suitzarrak 1934an sintetizatu zuen.

Erreferentziak[aldatu | aldatu iturburu kodea]

Kanpo estekak[aldatu | aldatu iturburu kodea]