Ergosterol

Wikipedia, Entziklopedia askea
Ergosterol
Ergosterol structure.svg
Formula kimikoaC28H44O
SMILES kanonikoa2D eredua
SMILES isomerikoa
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC=C4[C@@]3(CC[C@@H](C4)O)C)C
InChl3D eredua
Masa molekularra396,339 Da
Erabilera
Tratatzen duhipoparatiroidismo eta hipofosfatemia familiar
Rolaprobitamina
Identifikatzaileak
InChlKeyDNVPQKQSNYMLRS-APGDWVJJSA-N
CAS zenbakia57-87-4
ChemSpider392539
PubChem444679
Reaxys2338604
Gmelin16933
ChEMBLCHEMBL1232562
EC zenbakia200-352-7
ECHA100.000.320
CosIng33778
MeSHD004875
Human Metabolome DatabaseHMDB0000878
KNApSAcKC00023755 eta C00003652
UNIIZ30RAY509F
KEGGC01694
PDB LigandERG

Ergosterola esterolen saileko alkohola da(C28H44O).

Zekale-ainotik (Claviceps purpurea) lortzen da batez ere, baina garagar-legamiatik ere ateratzen da gaur egun. Animalia- eta landare-ehun batzuetan ere aurkitzen da. Mutur batean daukan hidroxilo taldeari esker molekula anfipatikoa da.

Erradiazio ultramorea jasotzen duenean, kaltziferol edo D2 bitamina bilakatzen da. Giza gorputzean, kaltzioa hezurretan eta hortzetan katalizatzea da haren eginkizun nagusia.

Erreferentziak[aldatu | aldatu iturburu kodea]

Kanpo estekak[aldatu | aldatu iturburu kodea]