Humuleno

Wikipedia, Entziklopedia askea
Humuleno
Humulene.png
Formula kimikoaC15H24
SMILES kanonikoa2D eredua
SMILES isomerikoa
C/C/1=C\CC(/C=C/C/C(=C/CC1)/C)(C)C
InChl3D eredua
Osatutakarbono
EponimoaHumulus
Masa molekularra204,187801 Da
Identifikatzaileak
InChlKeyFAMPSKZZVDUYOS-HRGUGZIWSA-N
CAS zenbakia6753-98-6
ChemSpider4444853
PubChem5281520
Reaxys1864446
Gmelin5768
ChEBI261515
ChEMBLCHEMBL251280
RTECS zenbakiaGZ4817500
DSSTox zenbakiaGZ4817500
EC zenbakia229-816-7
ECHA100.027.106
Human Metabolome DatabaseHMDB0036467
KNApSAcKC00003147
UNII54W56MD2WD
KEGGC09684

Humulenoa (baita ere α-humulenoa edo α-kariofilenoa) 11 karbonotako zikloa duen seskiterpeno bat da.

Jatorria[aldatu | aldatu iturburu kodea]

Lupuluan (Humulus lupulus) aurkitu zen lehen adiz, hortik bere izena[1]. Landarearen olio usaintsuetan agertzen da, landare barietarearen arabera kopuru ezberdinetan, baina %40a ere hartzera iristen da[2]. Humulenoa da garagardoari lupulu zaporea ematen diona. Beste landare batzutan ere aurkitzen da, kalamuan adibidez.

Erabilerak[aldatu | aldatu iturburu kodea]

Aipatu bezala, garagardogintzan erabiltzen da bereziki.

Medikuntzan ere erabiltzen da, ardi-belarriaren (Valeriana officinalis) antzeko efektuak ditu, antsietatea, urduritasuna eta insomnioaren tratamendutan erabiltzen da beraz[3].

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. «Hop Aroma and Flavor» realbeer.com (Noiz kontsultatua: 2018-12-27).
  2. (Ingelesez) Katsiotis, S. T.; Langezaal, C. R.; Scheffer, J. J. C.. (1989/12). «Analysis of the Volatile Compounds from Cones of Ten Humulus lupulus Cultivars» Planta Medica 55 (07): 634–634. doi:10.1055/s-2006-962205. ISSN 1439-0221. (Noiz kontsultatua: 2018-12-27).
  3. «Humulus lupulus Hop, Common hop, European Hop, PFAF Plant Database» pfaf.org (Noiz kontsultatua: 2018-12-27).
Lupuluaren loreak.


Kanpo estekak[aldatu | aldatu iturburu kodea]