Trioleina

Wikipedia, Entziklopedia askea
Trioleina
Formula kimikoaC57H104O6
SMILES kanonikoa2D eredua
SMILES isomerikoa
CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC
InChl3D eredua
Osatutakarbono, oxigeno eta hidrogeno
Masa molekularra884,783 Da
Identifikatzaileak
InChlKeyPHYFQTYBJUILEZ-IUPFWZBJSA-N
CAS zenbakia122-32-7
ChemSpider4593733
PubChem5497163
Reaxys1718692
Gmelin53753
EC zenbakia204-534-7
ECHA100.004.123
CosIng38756
MeSHD014304
RxNorm1368168
Human Metabolome DatabaseHMDB0005453
UNIIO05EC62663
NDF-RTN0000176032

Trioleina hiru azido oleiko (18:1) eta glizerina batek osatzen duten triglizerido bat da. formula du.

Oliba olioaren %4-30 osatzen du[1] eta Lorentzoren olioaren osagaietako bat da[2].

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. (Ingelesez) Thomas, Alfred. (2000-06-15). Fats and Fatty Oils. Wiley-VCH Verlag GmbH & Co. KGaA doi:10.1002/14356007.a10_173. ISBN 3527306730. (Noiz kontsultatua: 2018-12-02).
  2. «Redirecting» linkinghub.elsevier.com (Noiz kontsultatua: 2018-12-02).

Kanpo estekak[aldatu | aldatu iturburu kodea]