Linoleina

Wikipedia, Entziklopedia askea
Linoleina
Linolein.svg
Formula kimikoaC57H98O6
SMILES kanonikoa2D eredua
SMILES isomerikoa
CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)COC(=O)CCCCCCC/C=C\C/C=C\CCCCC
InChl3D eredua
Osatutakarbono, oxigeno eta hidrogeno
Masa molekularra878,736341 Da
Erabilera
Rolaplatelet aggregation inhibitors (en) Itzuli
Identifikatzaileak
InChlKeyHBOQXIRUPVQLKX-BBWANDEASA-N
CAS zenbakia537-40-6
ChemSpider71374
PubChem5322095
Gmelin75844
EC zenbakia208-666-6
ECHA100.007.880
CosIng80384
MeSHC009564
Human Metabolome DatabaseHMDB0005474
UNIIV5LJ52OGS7

Linoleina edo Trilinoleina hiru azido linoleiko (18:2) eta glizerina batek osatzen duten triglizerido bat da. formula du.

Biodiesela ekoizteko erabiltzen da, bai eta hainbat produktu kosmetikotan ere.

Erreferentziak[aldatu | aldatu iturburu kodea]

Kanpo estekak[aldatu | aldatu iturburu kodea]