Plastokinona

Wikipedia, Entziklopedia askea
Plastokinona
Plastoquinone is.svg
Formula kimikoaC53H80O2
SMILES kanonikoa2D eredua
SMILES isomerikoa
CC1=C(C(=O)C(=CC1=O)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)C
InChl3D eredua
Masa molekularra748,615832 Da
Identifikatzaileak
InChlKeyFKUYMLZIRPABFK-IQSNHBBHSA-N
CAS zenbakia4299-57-4
ChemSpider4938558
PubChem5375177
Gmelin28377
MeSHD010971
KNApSAcKC00002851
UNIIOAC30J69CN
KEGGC10385

Plastokinona (PQ) arnas katean edo elektroien garraio katean parte hartzen duen koentzima liposolugarria da. Egitura kimikoari dagokionez, kate isoprenoide luzea duen kinona bat da. Kinona hori oxidatu eta erreduzitu daiteke elektroiak galtzean edo irabazterakoan, hurrenez hurren.

Garrantzi biologikoa[aldatu | aldatu iturburu kodea]

Fotosintesian hartzen du parte, fase argidunean hain zuzen ere. Kloroplastoen tilakoideetan kokatzen da bigarren fotosistemaren eta zitokromoaren artean. Elektroien garraioaren ezinbesteko katebegi bat da[1]. Oxidazio erredukzio prozesu horretan hidrogeno protoi bat sartzen du estromatik tilakoidearen lumenera. Honi esker ATPak sintetizatzen dira[2].

Plastokinonaren (PQ) kokapena tilakoideko mintzean.

Erreferentziak[aldatu | aldatu iturburu kodea]

  1. (Ingelesez) Katoh, Sakae; Satoh, Kazuhiko; Hirano, Masahiko. (1980-09-01). «Plastoquinone as a common link between photosynthesis and respiration in a blue-green alga» Photosynthesis Research 1 (3): 149–162. doi:10.1007/BF00020594. ISSN 1573-5079. (Noiz kontsultatua: 2019-01-02).
  2. ZUBAY. (1993). Biochemistry (3rd edition). Wm. C.Brown Publishers ISBN 0-697-14267-1..


Kanpo estekak[aldatu | aldatu iturburu kodea]