Isomaltosa: berrikuspenen arteko aldeak
Ezabatutako edukia Gehitutako edukia
t Robota: Testu aldaketa automatikoa (-[Cc]ite[ _]book +erreferentzia) |
t Robota: Testu aldaketa automatikoa (-\{\{(.*\n)*\}\}\n\'\'\' +{{konposatu kimiko infotaula}}\n''') |
||
1. lerroa: | 1. lerroa: | ||
{{konposatu kimiko infotaula}} |
|||
{{Chembox |
|||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
|||
| verifiedrevid = 477168646 |
|||
| ImageFile = Isomaltose structure.svg |
|||
| ImageSize = |
|||
| PIN = Isomaltosa |
|||
| SystematicName = 6-''O''-α-<small>D</small>-Glukopiranosil-<small>D</small>-glukopiranosa |
|||
| OtherNames=''O''-α-<small>D</small>-glukopiranosil-α[1-6]-α-<small>D</small>-glukopiranosidoa |
|||
|Section1={{Chembox Identifiers |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 388333 |
|||
| InChI = 1/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
|||
| InChIKey = DLRVVLDZNNYCBX-RTPHMHGBBU |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = DLRVVLDZNNYCBX-RTPHMHGBSA-N |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CASNo = 499-40-1 |
|||
| PubChem = 439193 |
|||
| MeSHName = Isomaltosa |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEBI = 28189 |
|||
| SMILES = O(C[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)[C@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO |
|||
}} |
|||
|Section2={{Chembox Properties |
|||
| C=12 | H=22 | O=11 |
|||
| Appearance= |
|||
| Density= |
|||
| MeltingPt= |
|||
| BoilingPt= |
|||
| Solubility= |
|||
}} |
|||
|Section3={{Chembox Hazards |
|||
| MainHazards= |
|||
| FlashPt= |
|||
| AutoignitionPt = |
|||
}} |
|||
}} |
|||
'''Isomaltosa''' ernetako [[garagar]] aletan dagoen [[disakarido]]a da, bi [[glukosa]] molekulaz osaturikoa. |
'''Isomaltosa''' ernetako [[garagar]] aletan dagoen [[disakarido]]a da, bi [[glukosa]] molekulaz osaturikoa. |
||
18:02, 26 apirila 2020ko berrikusketa
Isomaltosa | |
---|---|
Formula kimikoa | C12H22O11 |
SMILES kanonikoa | 2D eredua |
SMILES isomerikoa | OC[C@H]1O[C@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
MolView | 3D eredua |
Konposizioa | beta-isomaltose (en) |
Mota | Disakarido |
Masa molekularra | 342,116212 Da |
Identifikatzaileak | |
InChlKey | DLRVVLDZNNYCBX-RTPHMHGBSA-N |
CAS zenbakia | 499-40-1 |
PubChem | 439193 |
Gmelin | 28189 |
EC zenbakia | 207-879-1 |
ECHA | 100.007.164 |
MeSH | D007534 |
Human Metabolome Database | HMDB0002923 |
KNApSAcK | C00018660 |
UNII | 67I334IX2M |
KEGG | C00252 |
Isomaltosa ernetako garagar aletan dagoen disakaridoa da, bi glukosa molekulaz osaturikoa.
Egitura
Isomaltosaren formula enpirikoa da. Lehen glukosako karbono anomerikoaren eta bigarren glukosako seigarren karbonoaren artean sortzen da α(1→6) lotura O-glikosidikoa[1]. Lotura hori osatzerakoan ura askatzen da eta oxigeno monokarboniliko batek zubi-lana egiten du bi molekulen artean. Bigarren glukosaren karbono anomerikoan dagoen hidroxilo taldea aske dagoenez ahalmen erreduzitzailea duen azukrea da. Horrela beraz maltosaren izen sistematikoa honako hau da:
Metabolismoa
Almidoiaren eta glukogenoaren hidrolisian agertzen da maltosarekin batera. Glukosaren karamelizazioaren produktuetako bat ere bada[2].
Isomaltasa entzimak hidrolisatzen du.
Erreferentziak
- ↑ Collins, Peter M.. (2005). Dictionary of carbohydrates. CRC Press, 556 or. ISBN 0849338298..
- ↑ (Ingelesez) SUGISAWA, HIRQSHI; EDO, HIROSHI. (1966-07). «The Thermal Degradation of Sugars I. Thermal Polymerization of Glucose» Journal of Food Science 31 (4): 561–565. doi: . ISSN 0022-1147. (Noiz kontsultatua: 2018-11-11).
Kanpo estekak
Karbono hidratoak | ||
---|---|---|
|